C16H13FN4O — CID 86782432
2-fluoro-3-methyl-N-(4-phenyl-1,2,4-triazol-3-yl)benzamide (PubChem CID 86782432) has the molecular formula C16H13FN4O and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-(4-phenyl-1,2,4-triazol-3-yl)benzamide.
| Compound Name | 2-fluoro-3-methyl-N-(4-phenyl-1,2,4-triazol-3-yl)benzamide |
|---|---|
| PubChem CID | 86782432 |
| Molecular Formula | C16H13FN4O |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-fluoro-3-methyl-N-(4-phenyl-1,2,4-triazol-3-yl)benzamide |
| SMILES | Cc1cccc(C(=O)Nc2nncn2-c2ccccc2)c1F |
| InChI | InChI=1S/C16H13FN4O/c1-11-6-5-9-13(14(11)17)15(22)19-16-20-18-10-21(16)12-7-3-2-4-8-12/h2-10H,1H3,(H,19,20,22) |
| InChIKey | KYDXFMQXXYWRQJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |