C18H17FN4O — CID 146152227
2-fluoro-3-methyl-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide (PubChem CID 146152227) has the molecular formula C18H17FN4O and a molecular weight of 324.36 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide.
| Compound Name | 2-fluoro-3-methyl-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 146152227 |
| Molecular Formula | C18H17FN4O |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-fluoro-3-methyl-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCCc2cnn(-c3ccccc3)n2)c1F |
| InChI | InChI=1S/C18H17FN4O/c1-13-6-5-9-16(17(13)19)18(24)20-11-10-14-12-21-23(22-14)15-7-3-2-4-8-15/h2-9,12H,10-11H2,1H3,(H,20,24) |
| InChIKey | HRNRUVYTJGVDLZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |