C14H14N4O — CID 146097973
N-[2-(2-phenyltriazol-4-yl)ethyl]but-2-ynamide (PubChem CID 146097973) has the molecular formula C14H14N4O and a molecular weight of 254.29 g/mol. Its IUPAC name is N-[2-(2-phenyltriazol-4-yl)ethyl]but-2-ynamide.
| Compound Name | N-[2-(2-phenyltriazol-4-yl)ethyl]but-2-ynamide |
|---|---|
| PubChem CID | 146097973 |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-[2-(2-phenyltriazol-4-yl)ethyl]but-2-ynamide |
| SMILES | CC#CC(=O)NCCc1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H14N4O/c1-2-6-14(19)15-10-9-12-11-16-18(17-12)13-7-4-3-5-8-13/h3-5,7-8,11H,9-10H2,1H3,(H,15,19) |
| InChIKey | BQTYLWNATIEZTD-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|