C18H14F4N4O — CID 146152245
3-fluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 146152245) has the molecular formula C18H14F4N4O and a molecular weight of 378.33 g/mol. Its IUPAC name is 3-fluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-fluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 146152245 |
| Molecular Formula | C18H14F4N4O |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-fluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=C(NCCc1cnn(-c2ccccc2)n1)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H14F4N4O/c19-14-9-12(8-13(10-14)18(20,21)22)17(27)23-7-6-15-11-24-26(25-15)16-4-2-1-3-5-16/h1-5,8-11H,6-7H2,(H,23,27) |
| InChIKey | QZBMOUWHPZFSBT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |