C17H14F2N4O — CID 146152234
3,4-difluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide (PubChem CID 146152234) has the molecular formula C17H14F2N4O and a molecular weight of 328.32 g/mol. Its IUPAC name is 3,4-difluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide.
| Compound Name | 3,4-difluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 146152234 |
| Molecular Formula | C17H14F2N4O |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3,4-difluoro-N-[2-(2-phenyltriazol-4-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1cnn(-c2ccccc2)n1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H14F2N4O/c18-15-7-6-12(10-16(15)19)17(24)20-9-8-13-11-21-23(22-13)14-4-2-1-3-5-14/h1-7,10-11H,8-9H2,(H,20,24) |
| InChIKey | IKDQMHOTNAOIPW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |