C14H11F2N3OS — CID 7150810
3,4-difluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide (PubChem CID 7150810) has the molecular formula C14H11F2N3OS and a molecular weight of 307.33 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide.
| Compound Name | 3,4-difluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide |
|---|---|
| PubChem CID | 7150810 |
| Molecular Formula | C14H11F2N3OS |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 3,4-difluoro-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide |
| SMILES | O=C(NCCc1cn2ccsc2n1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11F2N3OS/c15-11-2-1-9(7-12(11)16)13(20)17-4-3-10-8-19-5-6-21-14(19)18-10/h1-2,5-8H,3-4H2,(H,17,20) |
| InChIKey | CTYGPRFHLPKMRK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |