C14H14N4O3S2 — CID 77083416
N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-sulfamoylbenzamide (PubChem CID 77083416) has the molecular formula C14H14N4O3S2 and a molecular weight of 350.43 g/mol. Its IUPAC name is N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-sulfamoylbenzamide.
| Compound Name | N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 77083416 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCCc2cn3ccsc3n2)cc1 |
| InChI | InChI=1S/C14H14N4O3S2/c15-23(20,21)12-3-1-10(2-4-12)13(19)16-6-5-11-9-18-7-8-22-14(18)17-11/h1-4,7-9H,5-6H2,(H,16,19)(H2,15,20,21) |
| InChIKey | DZJCLUFEHHUYAL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |