C16H17N3O2S — CID 7150814
2-ethoxy-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide (PubChem CID 7150814) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-ethoxy-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide.
| Compound Name | 2-ethoxy-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide |
|---|---|
| PubChem CID | 7150814 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 2-ethoxy-N-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCc1cn2ccsc2n1 |
| InChI | InChI=1S/C16H17N3O2S/c1-2-21-14-6-4-3-5-13(14)15(20)17-8-7-12-11-19-9-10-22-16(19)18-12/h3-6,9-11H,2,7-8H2,1H3,(H,17,20) |
| InChIKey | UNXRGLPRIZJOHA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |