C11H16N4OS — CID 110661644
1-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-propylurea (PubChem CID 110661644) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-propylurea.
| Compound Name | 1-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-propylurea |
|---|---|
| PubChem CID | 110661644 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 1-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)-3-propylurea |
| SMILES | CCCNC(=O)NCCc1cn2ccsc2n1 |
| InChI | InChI=1S/C11H16N4OS/c1-2-4-12-10(16)13-5-3-9-8-15-6-7-17-11(15)14-9/h6-8H,2-5H2,1H3,(H2,12,13,16) |
| InChIKey | XYKAMPREZSTQRP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |