C13H18N4OS — CID 110661647
1-cyclopentyl-3-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)urea (PubChem CID 110661647) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)urea.
| Compound Name | 1-cyclopentyl-3-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)urea |
|---|---|
| PubChem CID | 110661647 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 1-cyclopentyl-3-(2-imidazo[2,1-b][1,3]thiazol-6-ylethyl)urea |
| SMILES | O=C(NCCc1cn2ccsc2n1)NC1CCCC1 |
| InChI | InChI=1S/C13H18N4OS/c18-12(15-10-3-1-2-4-10)14-6-5-11-9-17-7-8-19-13(17)16-11/h7-10H,1-6H2,(H2,14,15,18) |
| InChIKey | QHVRWBNWWVCAAX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |