C11H15ClN4 — CID 71758233
N-[(2-phenyltriazol-4-yl)methyl]ethanamine;hydrochloride (PubChem CID 71758233) has the molecular formula C11H15ClN4 and a molecular weight of 238.72 g/mol. Its IUPAC name is N-[(2-phenyltriazol-4-yl)methyl]ethanamine;hydrochloride.
| Compound Name | N-[(2-phenyltriazol-4-yl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 71758233 |
| Molecular Formula | C11H15ClN4 |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-[(2-phenyltriazol-4-yl)methyl]ethanamine;hydrochloride |
| SMILES | CCNCc1cnn(-c2ccccc2)n1.Cl |
| InChI | InChI=1S/C11H14N4.ClH/c1-2-12-8-10-9-13-15(14-10)11-6-4-3-5-7-11;/h3-7,9,12H,2,8H2,1H3;1H |
| InChIKey | OOAPNLRIFQKEIQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |