C13H19N5 — CID 113410140
N-methyl-N'-[(2-phenyltriazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 113410140) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is N-methyl-N'-[(2-phenyltriazol-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[(2-phenyltriazol-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 113410140 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-methyl-N'-[(2-phenyltriazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | CNCCCNCc1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H19N5/c1-14-8-5-9-15-10-12-11-16-18(17-12)13-6-3-2-4-7-13/h2-4,6-7,11,14-15H,5,8-10H2,1H3 |
| InChIKey | FPKHGNWEPYOTHT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|