C15H18N6 — CID 104694524
2-(2-methylpyrazol-3-yl)-N-[(2-phenyltriazol-4-yl)methyl]ethanamine (PubChem CID 104694524) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-(2-methylpyrazol-3-yl)-N-[(2-phenyltriazol-4-yl)methyl]ethanamine.
| Compound Name | 2-(2-methylpyrazol-3-yl)-N-[(2-phenyltriazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 104694524 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-(2-methylpyrazol-3-yl)-N-[(2-phenyltriazol-4-yl)methyl]ethanamine |
| SMILES | Cn1nccc1CCNCc1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H18N6/c1-20-14(8-10-17-20)7-9-16-11-13-12-18-21(19-13)15-5-3-2-4-6-15/h2-6,8,10,12,16H,7,9,11H2,1H3 |
| InChIKey | AJPBITOFOWSRRS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|