C15H17N5 — CID 106583004
N-[2-(2-methylpyrazol-3-yl)ethyl]-1-phenylimidazol-2-amine (PubChem CID 106583004) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N-[2-(2-methylpyrazol-3-yl)ethyl]-1-phenylimidazol-2-amine.
| Compound Name | N-[2-(2-methylpyrazol-3-yl)ethyl]-1-phenylimidazol-2-amine |
|---|---|
| PubChem CID | 106583004 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N-[2-(2-methylpyrazol-3-yl)ethyl]-1-phenylimidazol-2-amine |
| SMILES | Cn1nccc1CCNc1nccn1-c1ccccc1 |
| InChI | InChI=1S/C15H17N5/c1-19-13(8-10-18-19)7-9-16-15-17-11-12-20(15)14-5-3-2-4-6-14/h2-6,8,10-12H,7,9H2,1H3,(H,16,17) |
| InChIKey | FQUFXEKYMNGQDZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |