C10H14N4 — CID 103001636
N-[2-(2-methylpyrazol-3-yl)ethyl]pyrrol-1-amine (PubChem CID 103001636) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is N-[2-(2-methylpyrazol-3-yl)ethyl]pyrrol-1-amine.
| Compound Name | N-[2-(2-methylpyrazol-3-yl)ethyl]pyrrol-1-amine |
|---|---|
| PubChem CID | 103001636 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N-[2-(2-methylpyrazol-3-yl)ethyl]pyrrol-1-amine |
| SMILES | Cn1nccc1CCNn1cccc1 |
| InChI | InChI=1S/C10H14N4/c1-13-10(4-6-11-13)5-7-12-14-8-2-3-9-14/h2-4,6,8-9,12H,5,7H2,1H3 |
| InChIKey | XRIAOUGYJYTDNN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |