C11H21N5 — CID 103001943
4-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]piperazin-1-amine (PubChem CID 103001943) has the molecular formula C11H21N5 and a molecular weight of 223.32 g/mol. Its IUPAC name is 4-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]piperazin-1-amine.
| Compound Name | 4-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]piperazin-1-amine |
|---|---|
| PubChem CID | 103001943 |
| Molecular Formula | C11H21N5 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 4-methyl-N-[2-(2-methylpyrazol-3-yl)ethyl]piperazin-1-amine |
| SMILES | CN1CCN(NCCc2ccnn2C)CC1 |
| InChI | InChI=1S/C11H21N5/c1-14-7-9-16(10-8-14)13-6-4-11-3-5-12-15(11)2/h3,5,13H,4,6-10H2,1-2H3 |
| InChIKey | INWMFBVGFWBYDD-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |