C11H10FN3O2 — CID 115696967
2-fluoro-3-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide (PubChem CID 115696967) has the molecular formula C11H10FN3O2 and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-fluoro-3-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide.
| Compound Name | 2-fluoro-3-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 115696967 |
| Molecular Formula | C11H10FN3O2 |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-fluoro-3-methyl-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
| SMILES | Cc1noc(NC(=O)c2cccc(C)c2F)n1 |
| InChI | InChI=1S/C11H10FN3O2/c1-6-4-3-5-8(9(6)12)10(16)14-11-13-7(2)15-17-11/h3-5H,1-2H3,(H,13,14,15,16) |
| InChIKey | ZYTIXZIMLFGHHF-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |