C8H7N3O3 — CID 103618054
N-(3-methyl-1,2,4-oxadiazol-5-yl)furan-2-carboxamide (PubChem CID 103618054) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is N-(3-methyl-1,2,4-oxadiazol-5-yl)furan-2-carboxamide.
| Compound Name | N-(3-methyl-1,2,4-oxadiazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 103618054 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | N-(3-methyl-1,2,4-oxadiazol-5-yl)furan-2-carboxamide |
| SMILES | Cc1noc(NC(=O)c2ccco2)n1 |
| InChI | InChI=1S/C8H7N3O3/c1-5-9-8(14-11-5)10-7(12)6-3-2-4-13-6/h2-4H,1H3,(H,9,10,11,12) |
| InChIKey | IEYGHYYSKARPTA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |