C9H10N4O2 — CID 86789673
N-(2,5-dimethyl-1,2,4-triazol-3-yl)furan-2-carboxamide (PubChem CID 86789673) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is N-(2,5-dimethyl-1,2,4-triazol-3-yl)furan-2-carboxamide.
| Compound Name | N-(2,5-dimethyl-1,2,4-triazol-3-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 86789673 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | N-(2,5-dimethyl-1,2,4-triazol-3-yl)furan-2-carboxamide |
| SMILES | Cc1nc(NC(=O)c2ccco2)n(C)n1 |
| InChI | InChI=1S/C9H10N4O2/c1-6-10-9(13(2)12-6)11-8(14)7-4-3-5-15-7/h3-5H,1-2H3,(H,10,11,12,14) |
| InChIKey | HMRCIERLNDGCBX-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |