C10H9N3O4 — CID 104938878
3,5-dihydroxy-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide (PubChem CID 104938878) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3,5-dihydroxy-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide.
| Compound Name | 3,5-dihydroxy-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
|---|---|
| PubChem CID | 104938878 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3,5-dihydroxy-N-(3-methyl-1,2,4-oxadiazol-5-yl)benzamide |
| SMILES | Cc1noc(NC(=O)c2cc(O)cc(O)c2)n1 |
| InChI | InChI=1S/C10H9N3O4/c1-5-11-10(17-13-5)12-9(16)6-2-7(14)4-8(15)3-6/h2-4,14-15H,1H3,(H,11,12,13,16) |
| InChIKey | PQHTYOYSQLHSQE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |