C15H17N5O — CID 114387472
N-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide (PubChem CID 114387472) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is N-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide.
| Compound Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 114387472 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(5,6-dimethyl-1,2,4-triazin-3-yl)-1,2,3,4-tetrahydroisoquinoline-7-carboxamide |
| SMILES | Cc1nnc(NC(=O)c2ccc3c(c2)CNCC3)nc1C |
| InChI | InChI=1S/C15H17N5O/c1-9-10(2)19-20-15(17-9)18-14(21)12-4-3-11-5-6-16-8-13(11)7-12/h3-4,7,16H,5-6,8H2,1-2H3,(H,17,18,20,21) |
| InChIKey | NDEIEOQKFSJGOB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |