C13H15F3N2O3 — CID 66898299
N-methyl-1,2,3,4-tetrahydroisoquinoline-7-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 66898299) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is N-methyl-1,2,3,4-tetrahydroisoquinoline-7-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-methyl-1,2,3,4-tetrahydroisoquinoline-7-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66898299 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-methyl-1,2,3,4-tetrahydroisoquinoline-7-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)c1ccc2c(c1)CNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H14N2O.C2HF3O2/c1-12-11(14)9-3-2-8-4-5-13-7-10(8)6-9;3-2(4,5)1(6)7/h2-3,6,13H,4-5,7H2,1H3,(H,12,14);(H,6,7) |
| InChIKey | SPQBQRSFEIUZAQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |