C12H13F3N2O5 — CID 122438006
N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 122438006) has the molecular formula C12H13F3N2O5 and a molecular weight of 322.24 g/mol. Its IUPAC name is N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 122438006 |
| Molecular Formula | C12H13F3N2O5 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-8-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NO)c1ccc2c(c1)OCCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H12N2O3.C2HF3O2/c13-10(12-14)7-1-2-8-6-11-3-4-15-9(8)5-7;3-2(4,5)1(6)7/h1-2,5,11,14H,3-4,6H2,(H,12,13);(H,6,7) |
| InChIKey | ZQFDGMMTNJTQIF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|