C16H23N2O4+ — CID 140732939
4-(2,2-dimethylpropanoyl)-N-hydroxy-4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-ium-8-carboxamide (PubChem CID 140732939) has the molecular formula C16H23N2O4+ and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-N-hydroxy-4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-ium-8-carboxamide.
| Compound Name | 4-(2,2-dimethylpropanoyl)-N-hydroxy-4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-ium-8-carboxamide |
|---|---|
| PubChem CID | 140732939 |
| Molecular Formula | C16H23N2O4+ |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-N-hydroxy-4-methyl-3,5-dihydro-2H-1,4-benzoxazepin-4-ium-8-carboxamide |
| SMILES | CC(C)(C)C(=O)[N+]1(C)CCOc2cc(C(=O)NO)ccc2C1 |
| InChI | InChI=1S/C16H22N2O4/c1-16(2,3)15(20)18(4)7-8-22-13-9-11(14(19)17-21)5-6-12(13)10-18/h5-6,9H,7-8,10H2,1-4H3,(H-,17,19,21)/p+1 |
| InChIKey | ASJAPSNIYNPFIB-UHFFFAOYSA-O |
| XLogP | 1.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|