C10H12N2O3 — CID 122485771
N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-carboxamide (PubChem CID 122485771) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-carboxamide.
| Compound Name | N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-carboxamide |
|---|---|
| PubChem CID | 122485771 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | N-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-7-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)CNCCO2 |
| InChI | InChI=1S/C10H12N2O3/c13-10(12-14)7-1-2-9-8(5-7)6-11-3-4-15-9/h1-2,5,11,14H,3-4,6H2,(H,12,13) |
| InChIKey | OFDWLGMPYLPARH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|