C16H16ClNO3 — CID 86647851
2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl benzoate;hydrochloride (PubChem CID 86647851) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl benzoate;hydrochloride.
| Compound Name | 2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl benzoate;hydrochloride |
|---|---|
| PubChem CID | 86647851 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl benzoate;hydrochloride |
| SMILES | Cl.O=C(Oc1ccc2c(c1)CNCCO2)c1ccccc1 |
| InChI | InChI=1S/C16H15NO3.ClH/c18-16(12-4-2-1-3-5-12)20-14-6-7-15-13(10-14)11-17-8-9-19-15;/h1-7,10,17H,8-9,11H2;1H |
| InChIKey | UHMOJSLCKJKABC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|