C17H16FNO3 — CID 118130711
[4-(2-fluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl] benzoate (PubChem CID 118130711) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is [4-(2-fluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl] benzoate.
| Compound Name | [4-(2-fluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl] benzoate |
|---|---|
| PubChem CID | 118130711 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [4-(2-fluoroethyl)-2,3-dihydro-1,4-benzoxazin-6-yl] benzoate |
| SMILES | O=C(Oc1ccc2c(c1)N(CCF)CCO2)c1ccccc1 |
| InChI | InChI=1S/C17H16FNO3/c18-8-9-19-10-11-21-16-7-6-14(12-15(16)19)22-17(20)13-4-2-1-3-5-13/h1-7,12H,8-11H2 |
| InChIKey | HUVPWYWEEUPNNT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|