C11H16N2O2 — CID 83754217
2-(6-methoxy-2,3-dihydro-1,4-benzoxazin-4-yl)ethanamine (PubChem CID 83754217) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(6-methoxy-2,3-dihydro-1,4-benzoxazin-4-yl)ethanamine.
| Compound Name | 2-(6-methoxy-2,3-dihydro-1,4-benzoxazin-4-yl)ethanamine |
|---|---|
| PubChem CID | 83754217 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-(6-methoxy-2,3-dihydro-1,4-benzoxazin-4-yl)ethanamine |
| SMILES | COc1ccc2c(c1)N(CCN)CCO2 |
| InChI | InChI=1S/C11H16N2O2/c1-14-9-2-3-11-10(8-9)13(5-4-12)6-7-15-11/h2-3,8H,4-7,12H2,1H3 |
| InChIKey | DHGMFHQTANBRNN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |