C14H20N2O4S — CID 139004725
6-methoxy-4-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 139004725) has the molecular formula C14H20N2O4S and a molecular weight of 312.39 g/mol. Its IUPAC name is 6-methoxy-4-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 6-methoxy-4-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 139004725 |
| Molecular Formula | C14H20N2O4S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 6-methoxy-4-piperidin-1-ylsulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | COc1ccc2c(c1)N(S(=O)(=O)N1CCCCC1)CCO2 |
| InChI | InChI=1S/C14H20N2O4S/c1-19-12-5-6-14-13(11-12)16(9-10-20-14)21(17,18)15-7-3-2-4-8-15/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | KRLLVHALUTZHEZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |