C14H20N2O3S — CID 110865728
4-(3-methylpiperidin-1-yl)sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 110865728) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-(3-methylpiperidin-1-yl)sulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-(3-methylpiperidin-1-yl)sulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 110865728 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-(3-methylpiperidin-1-yl)sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | CC1CCCN(S(=O)(=O)N2CCOc3ccccc32)C1 |
| InChI | InChI=1S/C14H20N2O3S/c1-12-5-4-8-15(11-12)20(17,18)16-9-10-19-14-7-3-2-6-13(14)16/h2-3,6-7,12H,4-5,8-11H2,1H3 |
| InChIKey | NQXQNMBJJMOBKP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |