C15H22N2O2S — CID 110865729
1-(3-methylpiperidin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 110865729) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 1-(3-methylpiperidin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(3-methylpiperidin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 110865729 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-(3-methylpiperidin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CC1CCCN(S(=O)(=O)N2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C15H22N2O2S/c1-13-6-4-10-16(12-13)20(18,19)17-11-5-8-14-7-2-3-9-15(14)17/h2-3,7,9,13H,4-6,8,10-12H2,1H3 |
| InChIKey | OMIHAJFMZKVXFE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |