C17H22N2O2 — CID 108505638
1-(3,4-dihydro-2H-quinolin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione (PubChem CID 108505638) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione.
| Compound Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 108505638 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2-(3-methylpiperidin-1-yl)ethane-1,2-dione |
| SMILES | CC1CCCN(C(=O)C(=O)N2CCCc3ccccc32)C1 |
| InChI | InChI=1S/C17H22N2O2/c1-13-6-4-10-18(12-13)16(20)17(21)19-11-5-8-14-7-2-3-9-15(14)19/h2-3,7,9,13H,4-6,8,10-12H2,1H3 |
| InChIKey | QXRMMWDACUSOGH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|