C14H21N3O2S — CID 110865622
1-(4-methylpiperazin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline (PubChem CID 110865622) has the molecular formula C14H21N3O2S and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-(4-methylpiperazin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(4-methylpiperazin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 110865622 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-(4-methylpiperazin-1-yl)sulfonyl-3,4-dihydro-2H-quinoline |
| SMILES | CN1CCN(S(=O)(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C14H21N3O2S/c1-15-9-11-16(12-10-15)20(18,19)17-8-4-6-13-5-2-3-7-14(13)17/h2-3,5,7H,4,6,8-12H2,1H3 |
| InChIKey | HPEWHOMLQROUTP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |