C11H17N — CID 158932753
methane;1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 158932753) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is methane;1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | methane;1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 158932753 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | methane;1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | C.CN1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13N.CH4/c1-11-8-4-6-9-5-2-3-7-10(9)11;/h2-3,5,7H,4,6,8H2,1H3;1H4 |
| InChIKey | JJGSGQMGEVOASN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |