C9H10FN — CID 141340619
1-fluoro-3,4-dihydro-2H-quinoline (PubChem CID 141340619) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is 1-fluoro-3,4-dihydro-2H-quinoline.
| Compound Name | 1-fluoro-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 141340619 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 1-fluoro-3,4-dihydro-2H-quinoline |
| SMILES | FN1CCCc2ccccc21 |
| InChI | InChI=1S/C9H10FN/c10-11-7-3-5-8-4-1-2-6-9(8)11/h1-2,4,6H,3,5,7H2 |
| InChIKey | BCNSMFZOHYJUEA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|