C12H19N — CID 161272103
methane;1-methyl-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 161272103) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is methane;1-methyl-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | methane;1-methyl-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 161272103 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | methane;1-methyl-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | C.CN1CCCCc2ccccc21 |
| InChI | InChI=1S/C11H15N.CH4/c1-12-9-5-4-7-10-6-2-3-8-11(10)12;/h2-3,6,8H,4-5,7,9H2,1H3;1H4 |
| InChIKey | VDYLZWCIFFPJCH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |