C26H38N2 — CID 156800720
3-ethyl-1,1a,2,7b-tetrahydrocyclopropa[c]quinoline;1-methyl-2,3,4,5-tetrahydro-1-benzazepine;propane (PubChem CID 156800720) has the molecular formula C26H38N2 and a molecular weight of 378.60 g/mol. Its IUPAC name is 3-ethyl-1,1a,2,7b-tetrahydrocyclopropa[c]quinoline;1-methyl-2,3,4,5-tetrahydro-1-benzazepine;propane.
| Compound Name | 3-ethyl-1,1a,2,7b-tetrahydrocyclopropa[c]quinoline;1-methyl-2,3,4,5-tetrahydro-1-benzazepine;propane |
|---|---|
| PubChem CID | 156800720 |
| Molecular Formula | C26H38N2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | 3-ethyl-1,1a,2,7b-tetrahydrocyclopropa[c]quinoline;1-methyl-2,3,4,5-tetrahydro-1-benzazepine;propane |
| SMILES | CCC.CCN1CC2CC2c2ccccc21.CN1CCCCc2ccccc21 |
| InChI | InChI=1S/C12H15N.C11H15N.C3H8/c1-2-13-8-9-7-11(9)10-5-3-4-6-12(10)13;1-12-9-5-4-7-10-6-2-3-8-11(10)12;1-3-2/h3-6,9,11H,2,7-8H2,1H3;2-3,6,8H,4-5,7,9H2,1H3;3H2,1-2H3 |
| InChIKey | GYPDKVLDNXGRLJ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |