C15H22N2 — CID 4252433
1-ethyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline (PubChem CID 4252433) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 1-ethyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-ethyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 4252433 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-ethyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline |
| SMILES | CCN1CCC(N2CCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H22N2/c1-2-16-12-9-15(17-10-5-6-11-17)13-7-3-4-8-14(13)16/h3-4,7-8,15H,2,5-6,9-12H2,1H3 |
| InChIKey | CVOROLPQXZNRAX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |