C15H25NSi — CID 134935077
(1-ethyl-3,4-dihydro-2H-quinolin-4-yl)methyl-trimethylsilane (PubChem CID 134935077) has the molecular formula C15H25NSi and a molecular weight of 247.46 g/mol. Its IUPAC name is (1-ethyl-3,4-dihydro-2H-quinolin-4-yl)methyl-trimethylsilane.
| Compound Name | (1-ethyl-3,4-dihydro-2H-quinolin-4-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 134935077 |
| Molecular Formula | C15H25NSi |
| Molecular Weight | 247.46 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | (1-ethyl-3,4-dihydro-2H-quinolin-4-yl)methyl-trimethylsilane |
| SMILES | CCN1CCC(C[Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C15H25NSi/c1-5-16-11-10-13(12-17(2,3)4)14-8-6-7-9-15(14)16/h6-9,13H,5,10-12H2,1-4H3 |
| InChIKey | OBJWFLFGXUVEBM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|