C14H21NOSi — CID 122202357
1-[3-(trimethylsilylmethyl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 122202357) has the molecular formula C14H21NOSi and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-[3-(trimethylsilylmethyl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[3-(trimethylsilylmethyl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 122202357 |
| Molecular Formula | C14H21NOSi |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-[3-(trimethylsilylmethyl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C[Si](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C14H21NOSi/c1-11(16)15-9-12(10-17(2,3)4)13-7-5-6-8-14(13)15/h5-8,12H,9-10H2,1-4H3 |
| InChIKey | XGTMCGXCXLKEMX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|