C13H20N2 — CID 114336204
1-ethyl-N-methyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine (PubChem CID 114336204) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-ethyl-N-methyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine.
| Compound Name | 1-ethyl-N-methyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
|---|---|
| PubChem CID | 114336204 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-ethyl-N-methyl-2,3,4,5-tetrahydro-1-benzazepin-5-amine |
| SMILES | CCN1CCCC(NC)c2ccccc21 |
| InChI | InChI=1S/C13H20N2/c1-3-15-10-6-8-12(14-2)11-7-4-5-9-13(11)15/h4-5,7,9,12,14H,3,6,8,10H2,1-2H3 |
| InChIKey | BRMNNIZDYRRCAV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |