C20H24N2 — CID 4207738
1-benzyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline (PubChem CID 4207738) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 1-benzyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline.
| Compound Name | 1-benzyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 4207738 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-benzyl-4-pyrrolidin-1-yl-3,4-dihydro-2H-quinoline |
| SMILES | c1ccc(CN2CCC(N3CCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C20H24N2/c1-2-8-17(9-3-1)16-22-15-12-20(21-13-6-7-14-21)18-10-4-5-11-19(18)22/h1-5,8-11,20H,6-7,12-16H2 |
| InChIKey | RRNJEKWZUWPJNO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |