C11H15NO — CID 154059825
1-methoxy-2,3,4,5-tetrahydro-1-benzazepine (PubChem CID 154059825) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-methoxy-2,3,4,5-tetrahydro-1-benzazepine.
| Compound Name | 1-methoxy-2,3,4,5-tetrahydro-1-benzazepine |
|---|---|
| PubChem CID | 154059825 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 1-methoxy-2,3,4,5-tetrahydro-1-benzazepine |
| SMILES | CON1CCCCc2ccccc21 |
| InChI | InChI=1S/C11H15NO/c1-13-12-9-5-4-7-10-6-2-3-8-11(10)12/h2-3,6,8H,4-5,7,9H2,1H3 |
| InChIKey | UNQIJQARSJLDAG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |