C9H10NO- — CID 18542548
1-oxido-3,4-dihydro-2H-quinoline (PubChem CID 18542548) has the molecular formula C9H10NO- and a molecular weight of 148.19 g/mol. Its IUPAC name is 1-oxido-3,4-dihydro-2H-quinoline.
| Compound Name | 1-oxido-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 18542548 |
| Molecular Formula | C9H10NO- |
| Molecular Weight | 148.19 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 1-oxido-3,4-dihydro-2H-quinoline |
| SMILES | [O-]N1CCCc2ccccc21 |
| InChI | InChI=1S/C9H10NO/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6H,3,5,7H2/q-1 |
| InChIKey | SHMZXOXHBXXISG-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.19 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |