C17H25N — CID 154337689
1-(2-cyclohexylethyl)-3,4-dihydro-2H-quinoline (PubChem CID 154337689) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-(2-cyclohexylethyl)-3,4-dihydro-2H-quinoline.
| Compound Name | 1-(2-cyclohexylethyl)-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 154337689 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 1-(2-cyclohexylethyl)-3,4-dihydro-2H-quinoline |
| SMILES | c1ccc2c(c1)CCCN2CCC1CCCCC1 |
| InChI | InChI=1S/C17H25N/c1-2-7-15(8-3-1)12-14-18-13-6-10-16-9-4-5-11-17(16)18/h4-5,9,11,15H,1-3,6-8,10,12-14H2 |
| InChIKey | JRHHHJIGAXPDGC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |