C16H24N2 — CID 86323488
1-[2-[(3S)-piperidin-3-yl]ethyl]-3,4-dihydro-2H-quinoline (PubChem CID 86323488) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[2-[(3S)-piperidin-3-yl]ethyl]-3,4-dihydro-2H-quinoline.
| Compound Name | 1-[2-[(3S)-piperidin-3-yl]ethyl]-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 86323488 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-[2-[(3S)-piperidin-3-yl]ethyl]-3,4-dihydro-2H-quinoline |
| SMILES | c1ccc2c(c1)CCCN2CC[C@@H]1CCCNC1 |
| InChI | InChI=1S/C16H24N2/c1-2-8-16-15(6-1)7-4-11-18(16)12-9-14-5-3-10-17-13-14/h1-2,6,8,14,17H,3-5,7,9-13H2/t14-/m0/s1 |
| InChIKey | PQCIXNOOSQFYGI-AWEZNQCLSA-N |
| XLogP | 2.83 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |