C16H22N2O — CID 104525998
2-(piperidin-3-ylmethyl)-4,5-dihydro-3H-2-benzazepin-1-one (PubChem CID 104525998) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 2-(piperidin-3-ylmethyl)-4,5-dihydro-3H-2-benzazepin-1-one.
| Compound Name | 2-(piperidin-3-ylmethyl)-4,5-dihydro-3H-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104525998 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-(piperidin-3-ylmethyl)-4,5-dihydro-3H-2-benzazepin-1-one |
| SMILES | O=C1c2ccccc2CCCN1CC1CCCNC1 |
| InChI | InChI=1S/C16H22N2O/c19-16-15-8-2-1-6-14(15)7-4-10-18(16)12-13-5-3-9-17-11-13/h1-2,6,8,13,17H,3-5,7,9-12H2 |
| InChIKey | VALUQVNGBINDBQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |