C17H24N2O — CID 104526005
2-(3-pyrrolidin-2-ylpropyl)-4,5-dihydro-3H-2-benzazepin-1-one (PubChem CID 104526005) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(3-pyrrolidin-2-ylpropyl)-4,5-dihydro-3H-2-benzazepin-1-one.
| Compound Name | 2-(3-pyrrolidin-2-ylpropyl)-4,5-dihydro-3H-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104526005 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-(3-pyrrolidin-2-ylpropyl)-4,5-dihydro-3H-2-benzazepin-1-one |
| SMILES | O=C1c2ccccc2CCCN1CCCC1CCCN1 |
| InChI | InChI=1S/C17H24N2O/c20-17-16-10-2-1-6-14(16)7-4-12-19(17)13-5-9-15-8-3-11-18-15/h1-2,6,10,15,18H,3-5,7-9,11-13H2 |
| InChIKey | FCTJAFNBHLKTFF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |