C13H16BrNO — CID 104525155
2-(3-bromopropyl)-4,5-dihydro-3H-2-benzazepin-1-one (PubChem CID 104525155) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is 2-(3-bromopropyl)-4,5-dihydro-3H-2-benzazepin-1-one.
| Compound Name | 2-(3-bromopropyl)-4,5-dihydro-3H-2-benzazepin-1-one |
|---|---|
| PubChem CID | 104525155 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-(3-bromopropyl)-4,5-dihydro-3H-2-benzazepin-1-one |
| SMILES | O=C1c2ccccc2CCCN1CCCBr |
| InChI | InChI=1S/C13H16BrNO/c14-8-4-10-15-9-3-6-11-5-1-2-7-12(11)13(15)16/h1-2,5,7H,3-4,6,8-10H2 |
| InChIKey | BIESOQGOKQTSMN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|