C10H12NO2S- — CID 174943976
3,4-dihydro-2H-quinolin-1-ylmethanesulfinate (PubChem CID 174943976) has the molecular formula C10H12NO2S- and a molecular weight of 210.28 g/mol. Its IUPAC name is 3,4-dihydro-2H-quinolin-1-ylmethanesulfinate.
| Compound Name | 3,4-dihydro-2H-quinolin-1-ylmethanesulfinate |
|---|---|
| PubChem CID | 174943976 |
| Molecular Formula | C10H12NO2S- |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3,4-dihydro-2H-quinolin-1-ylmethanesulfinate |
| SMILES | O=S([O-])CN1CCCc2ccccc21 |
| InChI | InChI=1S/C10H13NO2S/c12-14(13)8-11-7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6H,3,5,7-8H2,(H,12,13)/p-1 |
| InChIKey | LGALWEKDNPGNSU-UHFFFAOYSA-M |
| XLogP | 1.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|